About 1-sulfanylheptyl pyrazine-2-carboxylate
1-sulfanylheptyl pyrazine-2-carboxylate (PubChem CID 123593985) has the molecular formula C12H18N2O2S
and a molecular weight of 254.35 g/mol. Its IUPAC name is 1-sulfanylheptyl pyrazine-2-carboxylate.
Molecular Properties
| Compound Name | 1-sulfanylheptyl pyrazine-2-carboxylate |
| PubChem CID | 123593985 |
| Molecular Formula | C12H18N2O2S |
| Molecular Weight | 254.35 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | 1-sulfanylheptyl pyrazine-2-carboxylate |
| SMILES | CCCCCCC(S)OC(=O)c1cnccn1 |
| InChI | InChI=1S/C12H18N2O2S/c1-2-3-4-5-6-11(17)16-12(15)10-9-13-7-8-14-10/h7-9,11,17H,2-6H2,1H3 |
| InChIKey | UFWNSRPQQKAYCK-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 52.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.35 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1-sulfanylheptyl pyrazine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-sulfanylheptyl pyrazine-2-carboxylate?
The IUPAC name of 1-sulfanylheptyl pyrazine-2-carboxylate (CID 123593985) is 1-sulfanylheptyl pyrazine-2-carboxylate.
What is the SMILES notation for 1-sulfanylheptyl pyrazine-2-carboxylate?
The canonical SMILES for 1-sulfanylheptyl pyrazine-2-carboxylate is CCCCCCC(S)OC(=O)c1cnccn1.
What is the InChIKey of 1-sulfanylheptyl pyrazine-2-carboxylate?
The InChIKey is UFWNSRPQQKAYCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N2O2S/c1-2-3-4-5-6-11(17)16-12(15)10-9-13-7-8-14-10/h7-9,11,17H,2-6H2,1H3.
What are the key properties of 1-sulfanylheptyl pyrazine-2-carboxylate?
1-sulfanylheptyl pyrazine-2-carboxylate has a molecular weight of 254.35 g/mol, XLogP of 2.86, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-sulfanylheptyl pyrazine-2-carboxylate is sourced from PubChem (CID 123593985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).