About 3-[(6-chloro-2-methyl-2,5-dihydropyridin-3-yl)methylideneamino]benzoic acid
3-[(6-chloro-2-methyl-2,5-dihydropyridin-3-yl)methylideneamino]benzoic acid (PubChem CID 123594332) has the molecular formula C14H13ClN2O2
and a molecular weight of 276.72 g/mol. Its IUPAC name is 3-[(6-chloro-2-methyl-2,5-dihydropyridin-3-yl)methylideneamino]benzoic acid.
Molecular Properties
| Compound Name | 3-[(6-chloro-2-methyl-2,5-dihydropyridin-3-yl)methylideneamino]benzoic acid |
| PubChem CID | 123594332 |
| Molecular Formula | C14H13ClN2O2 |
| Molecular Weight | 276.72 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | 3-[(6-chloro-2-methyl-2,5-dihydropyridin-3-yl)methylideneamino]benzoic acid |
| SMILES | CC1N=C(Cl)CC=C1/C=N/c1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C14H13ClN2O2/c1-9-11(5-6-13(15)17-9)8-16-12-4-2-3-10(7-12)14(18)19/h2-5,7-9H,6H2,1H3,(H,18,19)/b16-8+ |
| InChIKey | JRHMIQQLFWXQHT-LZYBPNLTSA-N |
| XLogP | 3.44 |
| TPSA | 62.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.72 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-[(6-chloro-2-methyl-2,5-dihydropyridin-3-yl)methylideneamino]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(6-chloro-2-methyl-2,5-dihydropyridin-3-yl)methylideneamino]benzoic acid?
The IUPAC name of 3-[(6-chloro-2-methyl-2,5-dihydropyridin-3-yl)methylideneamino]benzoic acid (CID 123594332) is 3-[(6-chloro-2-methyl-2,5-dihydropyridin-3-yl)methylideneamino]benzoic acid.
What is the SMILES notation for 3-[(6-chloro-2-methyl-2,5-dihydropyridin-3-yl)methylideneamino]benzoic acid?
The canonical SMILES for 3-[(6-chloro-2-methyl-2,5-dihydropyridin-3-yl)methylideneamino]benzoic acid is CC1N=C(Cl)CC=C1/C=N/c1cccc(C(=O)O)c1.
What is the InChIKey of 3-[(6-chloro-2-methyl-2,5-dihydropyridin-3-yl)methylideneamino]benzoic acid?
The InChIKey is JRHMIQQLFWXQHT-LZYBPNLTSA-N. The full InChI is InChI=1S/C14H13ClN2O2/c1-9-11(5-6-13(15)17-9)8-16-12-4-2-3-10(7-12)14(18)19/h2-5,7-9H,6H2,1H3,(H,18,19)/b16-8+.
What are the key properties of 3-[(6-chloro-2-methyl-2,5-dihydropyridin-3-yl)methylideneamino]benzoic acid?
3-[(6-chloro-2-methyl-2,5-dihydropyridin-3-yl)methylideneamino]benzoic acid has a molecular weight of 276.72 g/mol, XLogP of 3.44, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(6-chloro-2-methyl-2,5-dihydropyridin-3-yl)methylideneamino]benzoic acid is sourced from PubChem (CID 123594332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).