C19H19BFNO3 — CID 123596152
[(5S)-5-[[4-(3-fluorophenyl)phenyl]methyl]-3-formyl-2-oxopyrrolidin-1-yl]-methylborinic acid (PubChem CID 123596152) has the molecular formula C19H19BFNO3 and a molecular weight of 339.18 g/mol. Its IUPAC name is [(5S)-5-[[4-(3-fluorophenyl)phenyl]methyl]-3-formyl-2-oxopyrrolidin-1-yl]-methylborinic acid.
| Compound Name | [(5S)-5-[[4-(3-fluorophenyl)phenyl]methyl]-3-formyl-2-oxopyrrolidin-1-yl]-methylborinic acid |
|---|---|
| PubChem CID | 123596152 |
| Molecular Formula | C19H19BFNO3 |
| Molecular Weight | 339.18 g/mol |
| Exact Mass | 339.14 |
| IUPAC Name | [(5S)-5-[[4-(3-fluorophenyl)phenyl]methyl]-3-formyl-2-oxopyrrolidin-1-yl]-methylborinic acid |
| SMILES | CB(O)N1C(=O)C(C=O)C[C@H]1Cc1ccc(-c2cccc(F)c2)cc1 |
| InChI | InChI=1S/C19H19BFNO3/c1-20(25)22-18(11-16(12-23)19(22)24)9-13-5-7-14(8-6-13)15-3-2-4-17(21)10-15/h2-8,10,12,16,18,25H,9,11H2,1H3/t16?,18-/m1/s1 |
| InChIKey | ROQFMVUGLXFBHU-UHUGOGIASA-N |
| XLogP | 2.56 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.18 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|