C25H32F3N8O2+ — CID 123596612
2,2,2-trifluoro-N-[[4-[[2-(2-methyl-4-morpholin-4-ylanilino)-7H-purin-9-ium-6-yl]amino]cyclohexyl]methyl]acetamide (PubChem CID 123596612) has the molecular formula C25H32F3N8O2+ and a molecular weight of 533.58 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[[4-[[2-(2-methyl-4-morpholin-4-ylanilino)-7H-purin-9-ium-6-yl]amino]cyclohexyl]methyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[[4-[[2-(2-methyl-4-morpholin-4-ylanilino)-7H-purin-9-ium-6-yl]amino]cyclohexyl]methyl]acetamide |
|---|---|
| PubChem CID | 123596612 |
| Molecular Formula | C25H32F3N8O2+ |
| Molecular Weight | 533.58 g/mol |
| Exact Mass | 533.26 |
| IUPAC Name | 2,2,2-trifluoro-N-[[4-[[2-(2-methyl-4-morpholin-4-ylanilino)-7H-purin-9-ium-6-yl]amino]cyclohexyl]methyl]acetamide |
| SMILES | Cc1cc(N2CCOCC2)ccc1Nc1nc(NC2CCC(CNC(=O)C(F)(F)F)CC2)c2[nH]c[nH+]c2n1 |
| InChI | InChI=1S/C25H31F3N8O2/c1-15-12-18(36-8-10-38-11-9-36)6-7-19(15)33-24-34-21-20(30-14-31-21)22(35-24)32-17-4-2-16(3-5-17)13-29-23(37)25(26,27)28/h6-7,12,14,16-17H,2-5,8-11,13H2,1H3,(H,29,37)(H3,30,31,32,33,34,35)/p+1 |
| InChIKey | SLWKWNRQQBECOW-UHFFFAOYSA-O |
| XLogP | 3.31 |
| TPSA | 121.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.58 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|