C11H17FN2 — CID 123598247
1-(3-fluoro-6-methylcyclohexa-1,3-dien-1-yl)piperazine (PubChem CID 123598247) has the molecular formula C11H17FN2 and a molecular weight of 196.27 g/mol. Its IUPAC name is 1-(3-fluoro-6-methylcyclohexa-1,3-dien-1-yl)piperazine.
| Compound Name | 1-(3-fluoro-6-methylcyclohexa-1,3-dien-1-yl)piperazine |
|---|---|
| PubChem CID | 123598247 |
| Molecular Formula | C11H17FN2 |
| Molecular Weight | 196.27 g/mol |
| Exact Mass | 196.14 |
| IUPAC Name | 1-(3-fluoro-6-methylcyclohexa-1,3-dien-1-yl)piperazine |
| SMILES | CC1CC=C(F)C=C1N1CCNCC1 |
| InChI | InChI=1S/C11H17FN2/c1-9-2-3-10(12)8-11(9)14-6-4-13-5-7-14/h3,8-9,13H,2,4-7H2,1H3 |
| InChIKey | XYELUWOEAOFQJH-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.27 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |