C21H28BNO5 — CID 123598816
(1S)-1-(1-cyclohexylethyl)-2-hydroxy-2-(3-phenyloxiran-2-yl)-3-oxa-1-azonia-2-boranuidabicyclo[3.2.1]octane-4,6-dione (PubChem CID 123598816) has the molecular formula C21H28BNO5 and a molecular weight of 385.27 g/mol. Its IUPAC name is (1S)-1-(1-cyclohexylethyl)-2-hydroxy-2-(3-phenyloxiran-2-yl)-3-oxa-1-azonia-2-boranuidabicyclo[3.2.1]octane-4,6-dione.
| Compound Name | (1S)-1-(1-cyclohexylethyl)-2-hydroxy-2-(3-phenyloxiran-2-yl)-3-oxa-1-azonia-2-boranuidabicyclo[3.2.1]octane-4,6-dione |
|---|---|
| PubChem CID | 123598816 |
| Molecular Formula | C21H28BNO5 |
| Molecular Weight | 385.27 g/mol |
| Exact Mass | 385.21 |
| IUPAC Name | (1S)-1-(1-cyclohexylethyl)-2-hydroxy-2-(3-phenyloxiran-2-yl)-3-oxa-1-azonia-2-boranuidabicyclo[3.2.1]octane-4,6-dione |
| SMILES | CC(C1CCCCC1)[N@+]12CC(=O)C(C1)C(=O)O[B-]2(O)C1OC1c1ccccc1 |
| InChI | InChI=1S/C21H28BNO5/c1-14(15-8-4-2-5-9-15)23-12-17(18(24)13-23)21(25)28-22(23,26)20-19(27-20)16-10-6-3-7-11-16/h3,6-7,10-11,14-15,17,19-20,26H,2,4-5,8-9,12-13H2,1H3/t14?,17?,19?,20?,22?,23-/m1/s1 |
| InChIKey | HTOXFDHZZNMCTO-CCZMOBIESA-N |
| XLogP | 2.14 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.27 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|