C13H16ClN3 — CID 123599205
2-chloro-4-penta-1,3-dien-2-yl-6-pent-2-en-2-yl-1,3,5-triazine (PubChem CID 123599205) has the molecular formula C13H16ClN3 and a molecular weight of 249.74 g/mol. Its IUPAC name is 2-chloro-4-penta-1,3-dien-2-yl-6-pent-2-en-2-yl-1,3,5-triazine.
| Compound Name | 2-chloro-4-penta-1,3-dien-2-yl-6-pent-2-en-2-yl-1,3,5-triazine |
|---|---|
| PubChem CID | 123599205 |
| Molecular Formula | C13H16ClN3 |
| Molecular Weight | 249.74 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | 2-chloro-4-penta-1,3-dien-2-yl-6-pent-2-en-2-yl-1,3,5-triazine |
| SMILES | C=C(C=CC)c1nc(Cl)nc(C(C)=CCC)n1 |
| InChI | InChI=1S/C13H16ClN3/c1-5-7-9(3)11-15-12(10(4)8-6-2)17-13(14)16-11/h5,7-8H,3,6H2,1-2,4H3 |
| InChIKey | GLOJHTSDBDKMOX-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.74 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|