C8H12FNO — CID 123599863
5-fluoro-2,3,5,6,7,7a-hexahydro-1H-indol-2-ol (PubChem CID 123599863) has the molecular formula C8H12FNO and a molecular weight of 157.19 g/mol. Its IUPAC name is 5-fluoro-2,3,5,6,7,7a-hexahydro-1H-indol-2-ol.
| Compound Name | 5-fluoro-2,3,5,6,7,7a-hexahydro-1H-indol-2-ol |
|---|---|
| PubChem CID | 123599863 |
| Molecular Formula | C8H12FNO |
| Molecular Weight | 157.19 g/mol |
| Exact Mass | 157.09 |
| IUPAC Name | 5-fluoro-2,3,5,6,7,7a-hexahydro-1H-indol-2-ol |
| SMILES | OC1CC2=CC(F)CCC2N1 |
| InChI | InChI=1S/C8H12FNO/c9-6-1-2-7-5(3-6)4-8(11)10-7/h3,6-8,10-11H,1-2,4H2 |
| InChIKey | CPVJPIWUJQTBHL-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.19 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|