C18H20F3NO3 — CID 123600544
2-[2,6-dimethyl-4-(2,2,2-trifluoroethoxy)phenyl]-6,7,8,8a-tetrahydro-5H-indolizine-1,3-dione (PubChem CID 123600544) has the molecular formula C18H20F3NO3 and a molecular weight of 355.36 g/mol. Its IUPAC name is 2-[2,6-dimethyl-4-(2,2,2-trifluoroethoxy)phenyl]-6,7,8,8a-tetrahydro-5H-indolizine-1,3-dione.
| Compound Name | 2-[2,6-dimethyl-4-(2,2,2-trifluoroethoxy)phenyl]-6,7,8,8a-tetrahydro-5H-indolizine-1,3-dione |
|---|---|
| PubChem CID | 123600544 |
| Molecular Formula | C18H20F3NO3 |
| Molecular Weight | 355.36 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | 2-[2,6-dimethyl-4-(2,2,2-trifluoroethoxy)phenyl]-6,7,8,8a-tetrahydro-5H-indolizine-1,3-dione |
| SMILES | Cc1cc(OCC(F)(F)F)cc(C)c1C1C(=O)C2CCCCN2C1=O |
| InChI | InChI=1S/C18H20F3NO3/c1-10-7-12(25-9-18(19,20)21)8-11(2)14(10)15-16(23)13-5-3-4-6-22(13)17(15)24/h7-8,13,15H,3-6,9H2,1-2H3 |
| InChIKey | OBFHTFPSGOLBHT-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.36 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|