C22H22N4O — CID 123600646
2-(4,5-dimethylcyclohepta-1,3,6-trien-1-yl)-5-[(4-methylphenyl)methyl]-4-(1H-1,2,4-triazol-5-yl)-1,3-oxazole (PubChem CID 123600646) has the molecular formula C22H22N4O and a molecular weight of 358.45 g/mol. Its IUPAC name is 2-(4,5-dimethylcyclohepta-1,3,6-trien-1-yl)-5-[(4-methylphenyl)methyl]-4-(1H-1,2,4-triazol-5-yl)-1,3-oxazole.
| Compound Name | 2-(4,5-dimethylcyclohepta-1,3,6-trien-1-yl)-5-[(4-methylphenyl)methyl]-4-(1H-1,2,4-triazol-5-yl)-1,3-oxazole |
|---|---|
| PubChem CID | 123600646 |
| Molecular Formula | C22H22N4O |
| Molecular Weight | 358.45 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | 2-(4,5-dimethylcyclohepta-1,3,6-trien-1-yl)-5-[(4-methylphenyl)methyl]-4-(1H-1,2,4-triazol-5-yl)-1,3-oxazole |
| SMILES | CC1=CC=C(c2nc(-c3ncn[nH]3)c(Cc3ccc(C)cc3)o2)C=CC1C |
| InChI | InChI=1S/C22H22N4O/c1-14-4-8-17(9-5-14)12-19-20(21-23-13-24-26-21)25-22(27-19)18-10-6-15(2)16(3)7-11-18/h4-11,13,15H,12H2,1-3H3,(H,23,24,26) |
| InChIKey | USXQHZDHLGSNMN-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 67.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.45 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |