About 3-ethyl-1H-pyrrolo[3,2-b]pyridine-5-carbonitrile
3-ethyl-1H-pyrrolo[3,2-b]pyridine-5-carbonitrile (PubChem CID 123600772) has the molecular formula C10H9N3
and a molecular weight of 171.20 g/mol. Its IUPAC name is 3-ethyl-1H-pyrrolo[3,2-b]pyridine-5-carbonitrile.
Molecular Properties
| Compound Name | 3-ethyl-1H-pyrrolo[3,2-b]pyridine-5-carbonitrile |
| PubChem CID | 123600772 |
| Molecular Formula | C10H9N3 |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.08 |
| IUPAC Name | 3-ethyl-1H-pyrrolo[3,2-b]pyridine-5-carbonitrile |
| SMILES | CCc1c[nH]c2ccc(C#N)nc12 |
| InChI | InChI=1S/C10H9N3/c1-2-7-6-12-9-4-3-8(5-11)13-10(7)9/h3-4,6,12H,2H2,1H3 |
| InChIKey | BAIRIBRBRKXTAV-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 52.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-ethyl-1H-pyrrolo[3,2-b]pyridine-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-1H-pyrrolo[3,2-b]pyridine-5-carbonitrile?
The IUPAC name of 3-ethyl-1H-pyrrolo[3,2-b]pyridine-5-carbonitrile (CID 123600772) is 3-ethyl-1H-pyrrolo[3,2-b]pyridine-5-carbonitrile.
What is the SMILES notation for 3-ethyl-1H-pyrrolo[3,2-b]pyridine-5-carbonitrile?
The canonical SMILES for 3-ethyl-1H-pyrrolo[3,2-b]pyridine-5-carbonitrile is CCc1c[nH]c2ccc(C#N)nc12.
What is the InChIKey of 3-ethyl-1H-pyrrolo[3,2-b]pyridine-5-carbonitrile?
The InChIKey is BAIRIBRBRKXTAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N3/c1-2-7-6-12-9-4-3-8(5-11)13-10(7)9/h3-4,6,12H,2H2,1H3.
What are the key properties of 3-ethyl-1H-pyrrolo[3,2-b]pyridine-5-carbonitrile?
3-ethyl-1H-pyrrolo[3,2-b]pyridine-5-carbonitrile has a molecular weight of 171.20 g/mol, XLogP of 2.00, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-1H-pyrrolo[3,2-b]pyridine-5-carbonitrile is sourced from PubChem (CID 123600772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).