C13H7F3N2O — CID 123601065
5-[2-(trifluoromethyl)phenyl]-2,1,3-benzoxadiazole (PubChem CID 123601065) has the molecular formula C13H7F3N2O and a molecular weight of 264.21 g/mol. Its IUPAC name is 5-[2-(trifluoromethyl)phenyl]-2,1,3-benzoxadiazole.
| Compound Name | 5-[2-(trifluoromethyl)phenyl]-2,1,3-benzoxadiazole |
|---|---|
| PubChem CID | 123601065 |
| Molecular Formula | C13H7F3N2O |
| Molecular Weight | 264.21 g/mol |
| Exact Mass | 264.05 |
| IUPAC Name | 5-[2-(trifluoromethyl)phenyl]-2,1,3-benzoxadiazole |
| SMILES | FC(F)(F)c1ccccc1-c1ccc2nonc2c1 |
| InChI | InChI=1S/C13H7F3N2O/c14-13(15,16)10-4-2-1-3-9(10)8-5-6-11-12(7-8)18-19-17-11/h1-7H |
| InChIKey | GVAARZYINYPMLD-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.21 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |