C12H13FN4O7 — CID 123601248
(2S,3R,5R)-6-(fluoromethyl)-3-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]oxane-2,4,5-triol (PubChem CID 123601248) has the molecular formula C12H13FN4O7 and a molecular weight of 344.26 g/mol. Its IUPAC name is (2S,3R,5R)-6-(fluoromethyl)-3-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]oxane-2,4,5-triol.
| Compound Name | (2S,3R,5R)-6-(fluoromethyl)-3-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]oxane-2,4,5-triol |
|---|---|
| PubChem CID | 123601248 |
| Molecular Formula | C12H13FN4O7 |
| Molecular Weight | 344.26 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | (2S,3R,5R)-6-(fluoromethyl)-3-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]oxane-2,4,5-triol |
| SMILES | O=[N+]([O-])c1ccc(N[C@@H]2C(O)[C@@H](O)C(CF)O[C@@H]2O)c2nonc12 |
| InChI | InChI=1S/C12H13FN4O7/c13-3-6-10(18)11(19)9(12(20)23-6)14-4-1-2-5(17(21)22)8-7(4)15-24-16-8/h1-2,6,9-12,14,18-20H,3H2/t6?,9-,10+,11?,12+/m1/s1 |
| InChIKey | SFJIFJRZNKLUMN-CSFHWYQASA-N |
| XLogP | -0.68 |
| TPSA | 164.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.26 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|