C23H39NO2S — CID 123601525
3-(3-aminopropylsulfinylmethyl)-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-one (PubChem CID 123601525) has the molecular formula C23H39NO2S and a molecular weight of 393.64 g/mol. Its IUPAC name is 3-(3-aminopropylsulfinylmethyl)-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-one.
| Compound Name | 3-(3-aminopropylsulfinylmethyl)-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 123601525 |
| Molecular Formula | C23H39NO2S |
| Molecular Weight | 393.64 g/mol |
| Exact Mass | 393.27 |
| IUPAC Name | 3-(3-aminopropylsulfinylmethyl)-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-one |
| SMILES | CC12CCC3C(CCC4CC(CS(=O)CCCN)CCC43C)C1CCC2=O |
| InChI | InChI=1S/C23H39NO2S/c1-22-10-8-16(15-27(26)13-3-12-24)14-17(22)4-5-18-19-6-7-21(25)23(19,2)11-9-20(18)22/h16-20H,3-15,24H2,1-2H3 |
| InChIKey | FJXCLMBDXQYSNH-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.64 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |