C34H39FN2O4 — CID 123602399
ethene;N-[(2S,3R)-4-[(8R)-2-fluoro-8-methyl-6,7,8,9-tetrahydro-5H-benzo[7]annulen-6-yl]-3-hydroxy-1-phenylbutan-2-yl]-2-oxo-3-phenyl-1,3-oxazolidine-5-carboxamide (PubChem CID 123602399) has the molecular formula C34H39FN2O4 and a molecular weight of 558.69 g/mol. Its IUPAC name is ethene;N-[(2S,3R)-4-[(8R)-2-fluoro-8-methyl-6,7,8,9-tetrahydro-5H-benzo[7]annulen-6-yl]-3-hydroxy-1-phenylbutan-2-yl]-2-oxo-3-phenyl-1,3-oxazolidine-5-carboxamide.
| Compound Name | ethene;N-[(2S,3R)-4-[(8R)-2-fluoro-8-methyl-6,7,8,9-tetrahydro-5H-benzo[7]annulen-6-yl]-3-hydroxy-1-phenylbutan-2-yl]-2-oxo-3-phenyl-1,3-oxazolidine-5-carboxamide |
|---|---|
| PubChem CID | 123602399 |
| Molecular Formula | C34H39FN2O4 |
| Molecular Weight | 558.69 g/mol |
| Exact Mass | 558.29 |
| IUPAC Name | ethene;N-[(2S,3R)-4-[(8R)-2-fluoro-8-methyl-6,7,8,9-tetrahydro-5H-benzo[7]annulen-6-yl]-3-hydroxy-1-phenylbutan-2-yl]-2-oxo-3-phenyl-1,3-oxazolidine-5-carboxamide |
| SMILES | C=C.C[C@H]1Cc2cc(F)ccc2CC(C[C@@H](O)[C@H](Cc2ccccc2)NC(=O)C2CN(c3ccccc3)C(=O)O2)C1 |
| InChI | InChI=1S/C32H35FN2O4.C2H4/c1-21-14-23(16-24-12-13-26(33)19-25(24)15-21)18-29(36)28(17-22-8-4-2-5-9-22)34-31(37)30-20-35(32(38)39-30)27-10-6-3-7-11-27;1-2/h2-13,19,21,23,28-30,36H,14-18,20H2,1H3,(H,34,37);1-2H2/t21-,23?,28+,29-,30?;/m1./s1 |
| InChIKey | YFAVIFJWUCMDAE-AZSCXJFHSA-N |
| XLogP | 5.87 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.69 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|