About 5-methylidenethieno[2,3-b]pyrrole
5-methylidenethieno[2,3-b]pyrrole (PubChem CID 123603012) has the molecular formula C7H5NS
and a molecular weight of 135.19 g/mol. Its IUPAC name is 5-methylidenethieno[2,3-b]pyrrole.
Molecular Properties
| Compound Name | 5-methylidenethieno[2,3-b]pyrrole |
| PubChem CID | 123603012 |
| Molecular Formula | C7H5NS |
| Molecular Weight | 135.19 g/mol |
| Exact Mass | 135.01 |
| IUPAC Name | 5-methylidenethieno[2,3-b]pyrrole |
| SMILES | C=C1C=c2ccsc2=N1 |
| InChI | InChI=1S/C7H5NS/c1-5-4-6-2-3-9-7(6)8-5/h2-4H,1H2 |
| InChIKey | VSWDZAHQBGKOFI-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.19 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-methylidenethieno[2,3-b]pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methylidenethieno[2,3-b]pyrrole?
The IUPAC name of 5-methylidenethieno[2,3-b]pyrrole (CID 123603012) is 5-methylidenethieno[2,3-b]pyrrole.
What is the SMILES notation for 5-methylidenethieno[2,3-b]pyrrole?
The canonical SMILES for 5-methylidenethieno[2,3-b]pyrrole is C=C1C=c2ccsc2=N1.
What is the InChIKey of 5-methylidenethieno[2,3-b]pyrrole?
The InChIKey is VSWDZAHQBGKOFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5NS/c1-5-4-6-2-3-9-7(6)8-5/h2-4H,1H2.
What are the key properties of 5-methylidenethieno[2,3-b]pyrrole?
5-methylidenethieno[2,3-b]pyrrole has a molecular weight of 135.19 g/mol, XLogP of 0.68, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methylidenethieno[2,3-b]pyrrole is sourced from PubChem (CID 123603012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).