C5H10N2S — CID 123603312
1-(4,5-dihydro-1H-imidazol-2-yl)ethanethiol (PubChem CID 123603312) has the molecular formula C5H10N2S and a molecular weight of 130.22 g/mol. Its IUPAC name is 1-(4,5-dihydro-1H-imidazol-2-yl)ethanethiol.
| Compound Name | 1-(4,5-dihydro-1H-imidazol-2-yl)ethanethiol |
|---|---|
| PubChem CID | 123603312 |
| Molecular Formula | C5H10N2S |
| Molecular Weight | 130.22 g/mol |
| Exact Mass | 130.06 |
| IUPAC Name | 1-(4,5-dihydro-1H-imidazol-2-yl)ethanethiol |
| SMILES | CC(S)C1=NCCN1 |
| InChI | InChI=1S/C5H10N2S/c1-4(8)5-6-2-3-7-5/h4,8H,2-3H2,1H3,(H,6,7) |
| InChIKey | KYTOAKMDWUJANQ-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.22 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|