C23H32N4O4 — CID 123603344
7-benzyl-1-methyl-3-[3-(methylaminooxy)propyl]-8-propan-2-yloxy-6,7-dihydro-5H-pyrimido[4,5-b]azepine-2,4-dione (PubChem CID 123603344) has the molecular formula C23H32N4O4 and a molecular weight of 428.53 g/mol. Its IUPAC name is 7-benzyl-1-methyl-3-[3-(methylaminooxy)propyl]-8-propan-2-yloxy-6,7-dihydro-5H-pyrimido[4,5-b]azepine-2,4-dione.
| Compound Name | 7-benzyl-1-methyl-3-[3-(methylaminooxy)propyl]-8-propan-2-yloxy-6,7-dihydro-5H-pyrimido[4,5-b]azepine-2,4-dione |
|---|---|
| PubChem CID | 123603344 |
| Molecular Formula | C23H32N4O4 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.24 |
| IUPAC Name | 7-benzyl-1-methyl-3-[3-(methylaminooxy)propyl]-8-propan-2-yloxy-6,7-dihydro-5H-pyrimido[4,5-b]azepine-2,4-dione |
| SMILES | CNOCCCn1c(=O)c2c(n(C)c1=O)N=C(OC(C)C)C(Cc1ccccc1)CC2 |
| InChI | InChI=1S/C23H32N4O4/c1-16(2)31-21-18(15-17-9-6-5-7-10-17)11-12-19-20(25-21)26(4)23(29)27(22(19)28)13-8-14-30-24-3/h5-7,9-10,16,18,24H,8,11-15H2,1-4H3 |
| InChIKey | RJQNTYIALNDLKC-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 86.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|