C9H14BN2O2+ — CID 123603491
4-(4,5,5-trimethyl-4-methyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole (PubChem CID 123603491) has the molecular formula C9H14BN2O2+ and a molecular weight of 193.03 g/mol. Its IUPAC name is 4-(4,5,5-trimethyl-4-methyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole.
| Compound Name | 4-(4,5,5-trimethyl-4-methyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole |
|---|---|
| PubChem CID | 123603491 |
| Molecular Formula | C9H14BN2O2+ |
| Molecular Weight | 193.03 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | 4-(4,5,5-trimethyl-4-methyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole |
| SMILES | [CH2+]C1(C)OB(c2cn[nH]c2)OC1(C)C |
| InChI | InChI=1S/C9H14BN2O2/c1-8(2)9(3,4)14-10(13-8)7-5-11-12-6-7/h5-6H,1H2,2-4H3,(H,11,12)/q+1 |
| InChIKey | FOTKYLJOTZZQMY-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 47.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.03 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|