C24H27NO5 — CID 123603541
4-[[(4R,7S)-1,3-dihydroxy-2-methyl-4,5,6,7-tetrahydro-4,7-epoxyisoindol-5-yl]methyl]-2-(2,4,6-trimethylphenyl)cyclopentane-1,3-dione (PubChem CID 123603541) has the molecular formula C24H27NO5 and a molecular weight of 409.48 g/mol. Its IUPAC name is 4-[[(4R,7S)-1,3-dihydroxy-2-methyl-4,5,6,7-tetrahydro-4,7-epoxyisoindol-5-yl]methyl]-2-(2,4,6-trimethylphenyl)cyclopentane-1,3-dione.
| Compound Name | 4-[[(4R,7S)-1,3-dihydroxy-2-methyl-4,5,6,7-tetrahydro-4,7-epoxyisoindol-5-yl]methyl]-2-(2,4,6-trimethylphenyl)cyclopentane-1,3-dione |
|---|---|
| PubChem CID | 123603541 |
| Molecular Formula | C24H27NO5 |
| Molecular Weight | 409.48 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | 4-[[(4R,7S)-1,3-dihydroxy-2-methyl-4,5,6,7-tetrahydro-4,7-epoxyisoindol-5-yl]methyl]-2-(2,4,6-trimethylphenyl)cyclopentane-1,3-dione |
| SMILES | Cc1cc(C)c(C2C(=O)CC(CC3C[C@@H]4O[C@H]3c3c4c(O)n(C)c3O)C2=O)c(C)c1 |
| InChI | InChI=1S/C24H27NO5/c1-10-5-11(2)17(12(3)6-10)18-15(26)8-13(21(18)27)7-14-9-16-19-20(22(14)30-16)24(29)25(4)23(19)28/h5-6,13-14,16,18,22,28-29H,7-9H2,1-4H3/t13?,14?,16-,18?,22+/m0/s1 |
| InChIKey | ZARWGSHZEIPASY-DXCXXESWSA-N |
| XLogP | 3.83 |
| TPSA | 88.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.48 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|