C27H33ClN2O7 — CID 123603615
(12Z)-15-chloro-16,18-dihydroxy-12-[(2-oxo-2-piperidin-1-ylethoxy)amino]-8-prop-2-enoxy-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,12,15,17-hexaen-2-one (PubChem CID 123603615) has the molecular formula C27H33ClN2O7 and a molecular weight of 533.02 g/mol. Its IUPAC name is (12Z)-15-chloro-16,18-dihydroxy-12-[(2-oxo-2-piperidin-1-ylethoxy)amino]-8-prop-2-enoxy-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,12,15,17-hexaen-2-one.
| Compound Name | (12Z)-15-chloro-16,18-dihydroxy-12-[(2-oxo-2-piperidin-1-ylethoxy)amino]-8-prop-2-enoxy-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,12,15,17-hexaen-2-one |
|---|---|
| PubChem CID | 123603615 |
| Molecular Formula | C27H33ClN2O7 |
| Molecular Weight | 533.02 g/mol |
| Exact Mass | 532.20 |
| IUPAC Name | (12Z)-15-chloro-16,18-dihydroxy-12-[(2-oxo-2-piperidin-1-ylethoxy)amino]-8-prop-2-enoxy-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,12,15,17-hexaen-2-one |
| SMILES | C=CCOC1C=CCCOC(=O)c2c(O)cc(O)c(Cl)c2/C=C(\NOCC(=O)N2CCCCC2)C=CC1 |
| InChI | InChI=1S/C27H33ClN2O7/c1-2-14-35-20-10-4-7-15-36-27(34)25-21(26(28)23(32)17-22(25)31)16-19(9-8-11-20)29-37-18-24(33)30-12-5-3-6-13-30/h2,4,8-10,16-17,20,29,31-32H,1,3,5-7,11-15,18H2/b9-8?,10-4?,19-16- |
| InChIKey | OWCZYFSDMNTIPT-ZCCHDAMISA-N |
| XLogP | 4.26 |
| TPSA | 117.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.02 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|