C25H22N4O2S — CID 123603815
N-[5-methyl-2-(15-methyl-13-oxo-11-thia-6,14,17-triazatetracyclo[8.8.0.02,7.012,18]octadeca-1(10),2(7),3,5,8,12(18)-hexaen-5-yl)phenyl]prop-2-enamide (PubChem CID 123603815) has the molecular formula C25H22N4O2S and a molecular weight of 442.54 g/mol. Its IUPAC name is N-[5-methyl-2-(15-methyl-13-oxo-11-thia-6,14,17-triazatetracyclo[8.8.0.02,7.012,18]octadeca-1(10),2(7),3,5,8,12(18)-hexaen-5-yl)phenyl]prop-2-enamide.
| Compound Name | N-[5-methyl-2-(15-methyl-13-oxo-11-thia-6,14,17-triazatetracyclo[8.8.0.02,7.012,18]octadeca-1(10),2(7),3,5,8,12(18)-hexaen-5-yl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 123603815 |
| Molecular Formula | C25H22N4O2S |
| Molecular Weight | 442.54 g/mol |
| Exact Mass | 442.15 |
| IUPAC Name | N-[5-methyl-2-(15-methyl-13-oxo-11-thia-6,14,17-triazatetracyclo[8.8.0.02,7.012,18]octadeca-1(10),2(7),3,5,8,12(18)-hexaen-5-yl)phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(C)ccc1-c1ccc2c(ccc3sc4c(c32)NCC(C)NC4=O)n1 |
| InChI | InChI=1S/C25H22N4O2S/c1-4-21(30)29-19-11-13(2)5-6-15(19)17-8-7-16-18(28-17)9-10-20-22(16)23-24(32-20)25(31)27-14(3)12-26-23/h4-11,14,26H,1,12H2,2-3H3,(H,27,31)(H,29,30) |
| InChIKey | YTJGQRZOHUSRAN-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.54 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|