C16H27NO — CID 123604095
3-(2,6-dimethylhepta-1,3,5-trien-3-yloxy)-3-ethylpiperidine (PubChem CID 123604095) has the molecular formula C16H27NO and a molecular weight of 249.40 g/mol. Its IUPAC name is 3-(2,6-dimethylhepta-1,3,5-trien-3-yloxy)-3-ethylpiperidine.
| Compound Name | 3-(2,6-dimethylhepta-1,3,5-trien-3-yloxy)-3-ethylpiperidine |
|---|---|
| PubChem CID | 123604095 |
| Molecular Formula | C16H27NO |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.21 |
| IUPAC Name | 3-(2,6-dimethylhepta-1,3,5-trien-3-yloxy)-3-ethylpiperidine |
| SMILES | C=C(C)C(=CC=C(C)C)OC1(CC)CCCNC1 |
| InChI | InChI=1S/C16H27NO/c1-6-16(10-7-11-17-12-16)18-15(14(4)5)9-8-13(2)3/h8-9,17H,4,6-7,10-12H2,1-3,5H3 |
| InChIKey | GIFLEZCNDYXAOY-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|