C23H35ClN2O6 — CID 123605091
butyl methyl carbonate;3-(2-chloro-4-methylphenyl)-5-methyl-1,2,4-oxadiazole;methyl hexanoate (PubChem CID 123605091) has the molecular formula C23H35ClN2O6 and a molecular weight of 470.99 g/mol. Its IUPAC name is butyl methyl carbonate;3-(2-chloro-4-methylphenyl)-5-methyl-1,2,4-oxadiazole;methyl hexanoate.
| Compound Name | butyl methyl carbonate;3-(2-chloro-4-methylphenyl)-5-methyl-1,2,4-oxadiazole;methyl hexanoate |
|---|---|
| PubChem CID | 123605091 |
| Molecular Formula | C23H35ClN2O6 |
| Molecular Weight | 470.99 g/mol |
| Exact Mass | 470.22 |
| IUPAC Name | butyl methyl carbonate;3-(2-chloro-4-methylphenyl)-5-methyl-1,2,4-oxadiazole;methyl hexanoate |
| SMILES | CCCCCC(=O)OC.CCCCOC(=O)OC.Cc1ccc(-c2noc(C)n2)c(Cl)c1 |
| InChI | InChI=1S/C10H9ClN2O.C7H14O2.C6H12O3/c1-6-3-4-8(9(11)5-6)10-12-7(2)14-13-10;1-3-4-5-6-7(8)9-2;1-3-4-5-9-6(7)8-2/h3-5H,1-2H3;3-6H2,1-2H3;3-5H2,1-2H3 |
| InChIKey | OTGYIYIJFYNAMQ-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 100.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.99 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|