C34H38FNO7 — CID 123605518
(5-hydroxy-3,8,8,15,15,18-hexamethyl-19-oxo-7,9-dioxapentacyclo[11.5.1.01,5.06,11.014,16]nonadeca-2,11-dien-4-yl) 3-(2-fluorophenyl)-5-methyl-1,2-oxazole-4-carboxylate (PubChem CID 123605518) has the molecular formula C34H38FNO7 and a molecular weight of 591.68 g/mol. Its IUPAC name is (5-hydroxy-3,8,8,15,15,18-hexamethyl-19-oxo-7,9-dioxapentacyclo[11.5.1.01,5.06,11.014,16]nonadeca-2,11-dien-4-yl) 3-(2-fluorophenyl)-5-methyl-1,2-oxazole-4-carboxylate.
| Compound Name | (5-hydroxy-3,8,8,15,15,18-hexamethyl-19-oxo-7,9-dioxapentacyclo[11.5.1.01,5.06,11.014,16]nonadeca-2,11-dien-4-yl) 3-(2-fluorophenyl)-5-methyl-1,2-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 123605518 |
| Molecular Formula | C34H38FNO7 |
| Molecular Weight | 591.68 g/mol |
| Exact Mass | 591.26 |
| IUPAC Name | (5-hydroxy-3,8,8,15,15,18-hexamethyl-19-oxo-7,9-dioxapentacyclo[11.5.1.01,5.06,11.014,16]nonadeca-2,11-dien-4-yl) 3-(2-fluorophenyl)-5-methyl-1,2-oxazole-4-carboxylate |
| SMILES | CC1=CC23C(=O)C(C=C4COC(C)(C)OC4C2(O)C1OC(=O)c1c(-c2ccccc2F)noc1C)C1C(CC3C)C1(C)C |
| InChI | InChI=1S/C34H38FNO7/c1-16-14-33-17(2)12-22-25(31(22,4)5)21(27(33)37)13-19-15-40-32(6,7)42-29(19)34(33,39)28(16)41-30(38)24-18(3)43-36-26(24)20-10-8-9-11-23(20)35/h8-11,13-14,17,21-22,25,28-29,39H,12,15H2,1-7H3 |
| InChIKey | ZCYWSILULWGZJT-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 108.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.68 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|