C17H10FN4O+ — CID 123605569
12-(5-fluoro-2-hydroxyphenyl)-5,8-diaza-10-azoniatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-4-carbonitrile (PubChem CID 123605569) has the molecular formula C17H10FN4O+ and a molecular weight of 305.29 g/mol. Its IUPAC name is 12-(5-fluoro-2-hydroxyphenyl)-5,8-diaza-10-azoniatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-4-carbonitrile.
| Compound Name | 12-(5-fluoro-2-hydroxyphenyl)-5,8-diaza-10-azoniatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-4-carbonitrile |
|---|---|
| PubChem CID | 123605569 |
| Molecular Formula | C17H10FN4O+ |
| Molecular Weight | 305.29 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | 12-(5-fluoro-2-hydroxyphenyl)-5,8-diaza-10-azoniatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-4-carbonitrile |
| SMILES | N#Cc1cc2c(cn1)[nH]c1[nH+]cc(-c3cc(F)ccc3O)cc12 |
| InChI | InChI=1S/C17H9FN4O/c18-10-1-2-16(23)12(4-10)9-3-14-13-5-11(6-19)20-8-15(13)22-17(14)21-7-9/h1-5,7-8,23H,(H,21,22)/p+1 |
| InChIKey | NGWKARYMJNKKNN-UHFFFAOYSA-O |
| XLogP | 2.91 |
| TPSA | 86.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.29 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |