About 2-methyl-N-methylideneocta-2,4,7-trienamide
2-methyl-N-methylideneocta-2,4,7-trienamide (PubChem CID 123605624) has the molecular formula C10H13NO
and a molecular weight of 163.22 g/mol. Its IUPAC name is 2-methyl-N-methylideneocta-2,4,7-trienamide.
Molecular Properties
| Compound Name | 2-methyl-N-methylideneocta-2,4,7-trienamide |
| PubChem CID | 123605624 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | 2-methyl-N-methylideneocta-2,4,7-trienamide |
| SMILES | C=CCC=CC=C(C)C(=O)N=C |
| InChI | InChI=1S/C10H13NO/c1-4-5-6-7-8-9(2)10(12)11-3/h4,6-8H,1,3,5H2,2H3 |
| InChIKey | ASNDWSKOJHADKN-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-N-methylideneocta-2,4,7-trienamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-N-methylideneocta-2,4,7-trienamide?
The IUPAC name of 2-methyl-N-methylideneocta-2,4,7-trienamide (CID 123605624) is 2-methyl-N-methylideneocta-2,4,7-trienamide.
What is the SMILES notation for 2-methyl-N-methylideneocta-2,4,7-trienamide?
The canonical SMILES for 2-methyl-N-methylideneocta-2,4,7-trienamide is C=CCC=CC=C(C)C(=O)N=C.
What is the InChIKey of 2-methyl-N-methylideneocta-2,4,7-trienamide?
The InChIKey is ASNDWSKOJHADKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO/c1-4-5-6-7-8-9(2)10(12)11-3/h4,6-8H,1,3,5H2,2H3.
What are the key properties of 2-methyl-N-methylideneocta-2,4,7-trienamide?
2-methyl-N-methylideneocta-2,4,7-trienamide has a molecular weight of 163.22 g/mol, XLogP of 2.29, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-N-methylideneocta-2,4,7-trienamide is sourced from PubChem (CID 123605624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).