C12H15N3S — CID 123605685
1-[4-(1H-1,2,4-triazol-5-yl)phenyl]butane-2-thiol (PubChem CID 123605685) has the molecular formula C12H15N3S and a molecular weight of 233.34 g/mol. Its IUPAC name is 1-[4-(1H-1,2,4-triazol-5-yl)phenyl]butane-2-thiol.
| Compound Name | 1-[4-(1H-1,2,4-triazol-5-yl)phenyl]butane-2-thiol |
|---|---|
| PubChem CID | 123605685 |
| Molecular Formula | C12H15N3S |
| Molecular Weight | 233.34 g/mol |
| Exact Mass | 233.10 |
| IUPAC Name | 1-[4-(1H-1,2,4-triazol-5-yl)phenyl]butane-2-thiol |
| SMILES | CCC(S)Cc1ccc(-c2ncn[nH]2)cc1 |
| InChI | InChI=1S/C12H15N3S/c1-2-11(16)7-9-3-5-10(6-4-9)12-13-8-14-15-12/h3-6,8,11,16H,2,7H2,1H3,(H,13,14,15) |
| InChIKey | IBQUJIJKLZUVSF-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.34 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|