C21H31N7O — CID 123605781
4-N-[4-[6-(cyclopropylmethylamino)pyridazin-4-yl]pyrimidin-2-yl]-1-N-(2-methoxyethyl)cyclohexane-1,4-diamine (PubChem CID 123605781) has the molecular formula C21H31N7O and a molecular weight of 397.53 g/mol. Its IUPAC name is 4-N-[4-[6-(cyclopropylmethylamino)pyridazin-4-yl]pyrimidin-2-yl]-1-N-(2-methoxyethyl)cyclohexane-1,4-diamine.
| Compound Name | 4-N-[4-[6-(cyclopropylmethylamino)pyridazin-4-yl]pyrimidin-2-yl]-1-N-(2-methoxyethyl)cyclohexane-1,4-diamine |
|---|---|
| PubChem CID | 123605781 |
| Molecular Formula | C21H31N7O |
| Molecular Weight | 397.53 g/mol |
| Exact Mass | 397.26 |
| IUPAC Name | 4-N-[4-[6-(cyclopropylmethylamino)pyridazin-4-yl]pyrimidin-2-yl]-1-N-(2-methoxyethyl)cyclohexane-1,4-diamine |
| SMILES | COCCNC1CCC(Nc2nccc(-c3cnnc(NCC4CC4)c3)n2)CC1 |
| InChI | InChI=1S/C21H31N7O/c1-29-11-10-22-17-4-6-18(7-5-17)26-21-23-9-8-19(27-21)16-12-20(28-25-14-16)24-13-15-2-3-15/h8-9,12,14-15,17-18,22H,2-7,10-11,13H2,1H3,(H,24,28)(H,23,26,27) |
| InChIKey | PZDLCHGHWLACEF-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 96.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.53 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|