C28H37N3 — CID 123605932
4-[3-(4-ethylphenyl)-1H-pyrazol-5-yl]-1-hexyl-4-phenylpiperidine (PubChem CID 123605932) has the molecular formula C28H37N3 and a molecular weight of 415.63 g/mol. Its IUPAC name is 4-[3-(4-ethylphenyl)-1H-pyrazol-5-yl]-1-hexyl-4-phenylpiperidine.
| Compound Name | 4-[3-(4-ethylphenyl)-1H-pyrazol-5-yl]-1-hexyl-4-phenylpiperidine |
|---|---|
| PubChem CID | 123605932 |
| Molecular Formula | C28H37N3 |
| Molecular Weight | 415.63 g/mol |
| Exact Mass | 415.30 |
| IUPAC Name | 4-[3-(4-ethylphenyl)-1H-pyrazol-5-yl]-1-hexyl-4-phenylpiperidine |
| SMILES | CCCCCCN1CCC(c2ccccc2)(c2cc(-c3ccc(CC)cc3)n[nH]2)CC1 |
| InChI | InChI=1S/C28H37N3/c1-3-5-6-10-19-31-20-17-28(18-21-31,25-11-8-7-9-12-25)27-22-26(29-30-27)24-15-13-23(4-2)14-16-24/h7-9,11-16,22H,3-6,10,17-21H2,1-2H3,(H,29,30) |
| InChIKey | KUJCNVWJRPPZKP-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.63 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|