About 2-ethyl-3-methyltricyclo[2.2.0.02,6]hexane
2-ethyl-3-methyltricyclo[2.2.0.02,6]hexane (PubChem CID 123606065) has the molecular formula C9H14
and a molecular weight of 122.21 g/mol. Its IUPAC name is 2-ethyl-3-methyltricyclo[2.2.0.02,6]hexane.
Molecular Properties
| Compound Name | 2-ethyl-3-methyltricyclo[2.2.0.02,6]hexane |
| PubChem CID | 123606065 |
| Molecular Formula | C9H14 |
| Molecular Weight | 122.21 g/mol |
| Exact Mass | 122.11 |
| IUPAC Name | 2-ethyl-3-methyltricyclo[2.2.0.02,6]hexane |
| SMILES | CCC12C(C)C3CC1C32 |
| InChI | InChI=1S/C9H14/c1-3-9-5(2)6-4-7(9)8(6)9/h5-8H,3-4H2,1-2H3 |
| InChIKey | YTXNVYOAUBTJFJ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.21 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-ethyl-3-methyltricyclo[2.2.0.02,6]hexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-3-methyltricyclo[2.2.0.02,6]hexane?
The IUPAC name of 2-ethyl-3-methyltricyclo[2.2.0.02,6]hexane (CID 123606065) is 2-ethyl-3-methyltricyclo[2.2.0.02,6]hexane.
What is the SMILES notation for 2-ethyl-3-methyltricyclo[2.2.0.02,6]hexane?
The canonical SMILES for 2-ethyl-3-methyltricyclo[2.2.0.02,6]hexane is CCC12C(C)C3CC1C32.
What is the InChIKey of 2-ethyl-3-methyltricyclo[2.2.0.02,6]hexane?
The InChIKey is YTXNVYOAUBTJFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14/c1-3-9-5(2)6-4-7(9)8(6)9/h5-8H,3-4H2,1-2H3.
What are the key properties of 2-ethyl-3-methyltricyclo[2.2.0.02,6]hexane?
2-ethyl-3-methyltricyclo[2.2.0.02,6]hexane has a molecular weight of 122.21 g/mol, XLogP of 2.30, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-3-methyltricyclo[2.2.0.02,6]hexane is sourced from PubChem (CID 123606065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).