C22H23N5O2 — CID 123606182
6-(benzylamino)-N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-5-methanimidoylpyridine-3-carboxamide (PubChem CID 123606182) has the molecular formula C22H23N5O2 and a molecular weight of 389.46 g/mol. Its IUPAC name is 6-(benzylamino)-N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-5-methanimidoylpyridine-3-carboxamide.
| Compound Name | 6-(benzylamino)-N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-5-methanimidoylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 123606182 |
| Molecular Formula | C22H23N5O2 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.19 |
| IUPAC Name | 6-(benzylamino)-N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-5-methanimidoylpyridine-3-carboxamide |
| SMILES | [H]/N=C/c1cc(C(=O)NCc2c(C)cc(C)[nH]c2=O)cnc1NCc1ccccc1 |
| InChI | InChI=1S/C22H23N5O2/c1-14-8-15(2)27-22(29)19(14)13-26-21(28)18-9-17(10-23)20(25-12-18)24-11-16-6-4-3-5-7-16/h3-10,12,23H,11,13H2,1-2H3,(H,24,25)(H,26,28)(H,27,29)/b23-10+ |
| InChIKey | IKUXGFJPOCUXAQ-AUEPDCJTSA-N |
| XLogP | 2.93 |
| TPSA | 110.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|