C16H31N3O — CID 123606415
2-(3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl)-4,7-dimethylcycloheptan-1-amine (PubChem CID 123606415) has the molecular formula C16H31N3O and a molecular weight of 281.44 g/mol. Its IUPAC name is 2-(3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl)-4,7-dimethylcycloheptan-1-amine.
| Compound Name | 2-(3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl)-4,7-dimethylcycloheptan-1-amine |
|---|---|
| PubChem CID | 123606415 |
| Molecular Formula | C16H31N3O |
| Molecular Weight | 281.44 g/mol |
| Exact Mass | 281.25 |
| IUPAC Name | 2-(3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl)-4,7-dimethylcycloheptan-1-amine |
| SMILES | CC1CCC(C)C(N)C(N2CCN3CCOCC3C2)C1 |
| InChI | InChI=1S/C16H31N3O/c1-12-3-4-13(2)16(17)15(9-12)19-6-5-18-7-8-20-11-14(18)10-19/h12-16H,3-11,17H2,1-2H3 |
| InChIKey | OBMILHHSMGEECY-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 41.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.44 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |