C16H16F3NO — CID 123606651
2-methyl-4-methylidene-5-[methyl-[(2,4,6-trifluorophenyl)methyl]amino]hexa-1,5-dien-3-one (PubChem CID 123606651) has the molecular formula C16H16F3NO and a molecular weight of 295.30 g/mol. Its IUPAC name is 2-methyl-4-methylidene-5-[methyl-[(2,4,6-trifluorophenyl)methyl]amino]hexa-1,5-dien-3-one.
| Compound Name | 2-methyl-4-methylidene-5-[methyl-[(2,4,6-trifluorophenyl)methyl]amino]hexa-1,5-dien-3-one |
|---|---|
| PubChem CID | 123606651 |
| Molecular Formula | C16H16F3NO |
| Molecular Weight | 295.30 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | 2-methyl-4-methylidene-5-[methyl-[(2,4,6-trifluorophenyl)methyl]amino]hexa-1,5-dien-3-one |
| SMILES | C=C(C)C(=O)C(=C)C(=C)N(C)Cc1c(F)cc(F)cc1F |
| InChI | InChI=1S/C16H16F3NO/c1-9(2)16(21)10(3)11(4)20(5)8-13-14(18)6-12(17)7-15(13)19/h6-7H,1,3-4,8H2,2,5H3 |
| InChIKey | HVFIABCVEPCELA-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.30 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|