C29H38N2O3S — CID 123606871
4-(azepan-1-yl)-11-hydroxy-8,8,10,15-tetramethyl-21-oxa-5-thia-3-azaheptacyclo[9.8.2.112,14.01,9.02,6.012,19.013,16]docosa-2(6),3,14-trien-22-one (PubChem CID 123606871) has the molecular formula C29H38N2O3S and a molecular weight of 494.70 g/mol. Its IUPAC name is 4-(azepan-1-yl)-11-hydroxy-8,8,10,15-tetramethyl-21-oxa-5-thia-3-azaheptacyclo[9.8.2.112,14.01,9.02,6.012,19.013,16]docosa-2(6),3,14-trien-22-one.
| Compound Name | 4-(azepan-1-yl)-11-hydroxy-8,8,10,15-tetramethyl-21-oxa-5-thia-3-azaheptacyclo[9.8.2.112,14.01,9.02,6.012,19.013,16]docosa-2(6),3,14-trien-22-one |
|---|---|
| PubChem CID | 123606871 |
| Molecular Formula | C29H38N2O3S |
| Molecular Weight | 494.70 g/mol |
| Exact Mass | 494.26 |
| IUPAC Name | 4-(azepan-1-yl)-11-hydroxy-8,8,10,15-tetramethyl-21-oxa-5-thia-3-azaheptacyclo[9.8.2.112,14.01,9.02,6.012,19.013,16]docosa-2(6),3,14-trien-22-one |
| SMILES | CC1=C2C(=O)C34C2C1CCC3C12COC4(O)C(C)C1C(C)(C)Cc1sc(N3CCCCCC3)nc12 |
| InChI | InChI=1S/C29H38N2O3S/c1-15-17-9-10-19-27-14-34-29(33,28(19)21(17)20(15)24(28)32)16(2)22(27)26(3,4)13-18-23(27)30-25(35-18)31-11-7-5-6-8-12-31/h16-17,19,21-22,33H,5-14H2,1-4H3 |
| InChIKey | KLQKADIMHWBZRK-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.70 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |