C22H33F2N3O3S — CID 123607002
2-(2,5-difluorophenyl)-5-[1-(2-methylpropylsulfonyl)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-6-yl]oxan-3-amine (PubChem CID 123607002) has the molecular formula C22H33F2N3O3S and a molecular weight of 457.59 g/mol. Its IUPAC name is 2-(2,5-difluorophenyl)-5-[1-(2-methylpropylsulfonyl)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-6-yl]oxan-3-amine.
| Compound Name | 2-(2,5-difluorophenyl)-5-[1-(2-methylpropylsulfonyl)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-6-yl]oxan-3-amine |
|---|---|
| PubChem CID | 123607002 |
| Molecular Formula | C22H33F2N3O3S |
| Molecular Weight | 457.59 g/mol |
| Exact Mass | 457.22 |
| IUPAC Name | 2-(2,5-difluorophenyl)-5-[1-(2-methylpropylsulfonyl)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-6-yl]oxan-3-amine |
| SMILES | CC(C)CS(=O)(=O)N1CCCC2CN(C3COC(c4cc(F)ccc4F)C(N)C3)CC21 |
| InChI | InChI=1S/C22H33F2N3O3S/c1-14(2)13-31(28,29)27-7-3-4-15-10-26(11-21(15)27)17-9-20(25)22(30-12-17)18-8-16(23)5-6-19(18)24/h5-6,8,14-15,17,20-22H,3-4,7,9-13,25H2,1-2H3 |
| InChIKey | MLABVQNCSKKOCJ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.59 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |