C12H20N+ — CID 123607054
3,4-dimethylhepta-1,3,5-trien-2-yl-ethylidene-methylazanium (PubChem CID 123607054) has the molecular formula C12H20N+ and a molecular weight of 178.30 g/mol. Its IUPAC name is 3,4-dimethylhepta-1,3,5-trien-2-yl-ethylidene-methylazanium.
| Compound Name | 3,4-dimethylhepta-1,3,5-trien-2-yl-ethylidene-methylazanium |
|---|---|
| PubChem CID | 123607054 |
| Molecular Formula | C12H20N+ |
| Molecular Weight | 178.30 g/mol |
| Exact Mass | 178.16 |
| IUPAC Name | 3,4-dimethylhepta-1,3,5-trien-2-yl-ethylidene-methylazanium |
| SMILES | C=C(C(C)=C(C)C=CC)/[N+](C)=C/C |
| InChI | InChI=1S/C12H20N/c1-7-9-10(3)11(4)12(5)13(6)8-2/h7-9H,5H2,1-4,6H3/q+1/b9-7?,11-10?,13-8+ |
| InChIKey | DFGKSMVYEZJFDJ-UGZFPUBWSA-N |
| XLogP | 3.15 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.30 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|