C30H37N5O5Si — CID 123607257
methyl 2,2-dimethyl-3-[[5-[4-[5-pyridin-3-yloxy-1-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]phenyl]-2-pyridinyl]oxy]propanoate (PubChem CID 123607257) has the molecular formula C30H37N5O5Si and a molecular weight of 575.74 g/mol. Its IUPAC name is methyl 2,2-dimethyl-3-[[5-[4-[5-pyridin-3-yloxy-1-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]phenyl]-2-pyridinyl]oxy]propanoate.
| Compound Name | methyl 2,2-dimethyl-3-[[5-[4-[5-pyridin-3-yloxy-1-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]phenyl]-2-pyridinyl]oxy]propanoate |
|---|---|
| PubChem CID | 123607257 |
| Molecular Formula | C30H37N5O5Si |
| Molecular Weight | 575.74 g/mol |
| Exact Mass | 575.26 |
| IUPAC Name | methyl 2,2-dimethyl-3-[[5-[4-[5-pyridin-3-yloxy-1-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]phenyl]-2-pyridinyl]oxy]propanoate |
| SMILES | COC(=O)C(C)(C)COc1ccc(-c2ccc(-c3nc(Oc4cccnc4)n(COCC[Si](C)(C)C)n3)cc2)cn1 |
| InChI | InChI=1S/C30H37N5O5Si/c1-30(2,28(36)37-3)20-39-26-14-13-24(18-32-26)22-9-11-23(12-10-22)27-33-29(40-25-8-7-15-31-19-25)35(34-27)21-38-16-17-41(4,5)6/h7-15,18-19H,16-17,20-21H2,1-6H3 |
| InChIKey | KDTZDZMHBGWMDM-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 110.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.74 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|