C15H17N3O — CID 123608232
1-[(2R)-6-isocyano-1,2,3,4-tetrahydronaphthalen-2-yl]piperazin-2-one (PubChem CID 123608232) has the molecular formula C15H17N3O and a molecular weight of 255.32 g/mol. Its IUPAC name is 1-[(2R)-6-isocyano-1,2,3,4-tetrahydronaphthalen-2-yl]piperazin-2-one.
| Compound Name | 1-[(2R)-6-isocyano-1,2,3,4-tetrahydronaphthalen-2-yl]piperazin-2-one |
|---|---|
| PubChem CID | 123608232 |
| Molecular Formula | C15H17N3O |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | 1-[(2R)-6-isocyano-1,2,3,4-tetrahydronaphthalen-2-yl]piperazin-2-one |
| SMILES | [C-]#[N+]c1ccc2c(c1)CC[C@@H](N1CCNCC1=O)C2 |
| InChI | InChI=1S/C15H17N3O/c1-16-13-4-2-12-9-14(5-3-11(12)8-13)18-7-6-17-10-15(18)19/h2,4,8,14,17H,3,5-7,9-10H2/t14-/m1/s1 |
| InChIKey | NYAWDIVAPPNWCI-CQSZACIVSA-N |
| XLogP | 1.53 |
| TPSA | 36.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|