C15H30O — CID 123608266
2-cyclopropyl-9,9-dimethyldecan-2-ol (PubChem CID 123608266) has the molecular formula C15H30O and a molecular weight of 226.40 g/mol. Its IUPAC name is 2-cyclopropyl-9,9-dimethyldecan-2-ol.
| Compound Name | 2-cyclopropyl-9,9-dimethyldecan-2-ol |
|---|---|
| PubChem CID | 123608266 |
| Molecular Formula | C15H30O |
| Molecular Weight | 226.40 g/mol |
| Exact Mass | 226.23 |
| IUPAC Name | 2-cyclopropyl-9,9-dimethyldecan-2-ol |
| SMILES | CC(C)(C)CCCCCCC(C)(O)C1CC1 |
| InChI | InChI=1S/C15H30O/c1-14(2,3)11-7-5-6-8-12-15(4,16)13-9-10-13/h13,16H,5-12H2,1-4H3 |
| InChIKey | KYSVTGMTRLBCKX-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.40 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|