About N-methyl-N-(2-methylprop-2-enylideneamino)-1,2,4-triazole-1-carboxamide
N-methyl-N-(2-methylprop-2-enylideneamino)-1,2,4-triazole-1-carboxamide (PubChem CID 123608790) has the molecular formula C8H11N5O
and a molecular weight of 193.21 g/mol. Its IUPAC name is N-methyl-N-(2-methylprop-2-enylideneamino)-1,2,4-triazole-1-carboxamide.
Molecular Properties
| Compound Name | N-methyl-N-(2-methylprop-2-enylideneamino)-1,2,4-triazole-1-carboxamide |
| PubChem CID | 123608790 |
| Molecular Formula | C8H11N5O |
| Molecular Weight | 193.21 g/mol |
| Exact Mass | 193.10 |
| IUPAC Name | N-methyl-N-(2-methylprop-2-enylideneamino)-1,2,4-triazole-1-carboxamide |
| SMILES | C=C(C)C=NN(C)C(=O)n1cncn1 |
| InChI | InChI=1S/C8H11N5O/c1-7(2)4-10-12(3)8(14)13-6-9-5-11-13/h4-6H,1H2,2-3H3 |
| InChIKey | VWHUCWXFMIRSFK-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 63.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.21 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-N-(2-methylprop-2-enylideneamino)-1,2,4-triazole-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-N-(2-methylprop-2-enylideneamino)-1,2,4-triazole-1-carboxamide?
The IUPAC name of N-methyl-N-(2-methylprop-2-enylideneamino)-1,2,4-triazole-1-carboxamide (CID 123608790) is N-methyl-N-(2-methylprop-2-enylideneamino)-1,2,4-triazole-1-carboxamide.
What is the SMILES notation for N-methyl-N-(2-methylprop-2-enylideneamino)-1,2,4-triazole-1-carboxamide?
The canonical SMILES for N-methyl-N-(2-methylprop-2-enylideneamino)-1,2,4-triazole-1-carboxamide is C=C(C)C=NN(C)C(=O)n1cncn1.
What is the InChIKey of N-methyl-N-(2-methylprop-2-enylideneamino)-1,2,4-triazole-1-carboxamide?
The InChIKey is VWHUCWXFMIRSFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N5O/c1-7(2)4-10-12(3)8(14)13-6-9-5-11-13/h4-6H,1H2,2-3H3.
What are the key properties of N-methyl-N-(2-methylprop-2-enylideneamino)-1,2,4-triazole-1-carboxamide?
N-methyl-N-(2-methylprop-2-enylideneamino)-1,2,4-triazole-1-carboxamide has a molecular weight of 193.21 g/mol, XLogP of 0.74, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-N-(2-methylprop-2-enylideneamino)-1,2,4-triazole-1-carboxamide is sourced from PubChem (CID 123608790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).