C31H48N2O6Si — CID 123608976
(4S,5R)-18-[tert-butyl(dimethyl)silyl]oxy-4,5-dimethyl-16-(piperidin-4-ylmethylamino)-3-oxabicyclo[12.4.0]octadeca-1(14),15,17-triene-2,8,9,10-tetrone (PubChem CID 123608976) has the molecular formula C31H48N2O6Si and a molecular weight of 572.82 g/mol. Its IUPAC name is (4S,5R)-18-[tert-butyl(dimethyl)silyl]oxy-4,5-dimethyl-16-(piperidin-4-ylmethylamino)-3-oxabicyclo[12.4.0]octadeca-1(14),15,17-triene-2,8,9,10-tetrone.
| Compound Name | (4S,5R)-18-[tert-butyl(dimethyl)silyl]oxy-4,5-dimethyl-16-(piperidin-4-ylmethylamino)-3-oxabicyclo[12.4.0]octadeca-1(14),15,17-triene-2,8,9,10-tetrone |
|---|---|
| PubChem CID | 123608976 |
| Molecular Formula | C31H48N2O6Si |
| Molecular Weight | 572.82 g/mol |
| Exact Mass | 572.33 |
| IUPAC Name | (4S,5R)-18-[tert-butyl(dimethyl)silyl]oxy-4,5-dimethyl-16-(piperidin-4-ylmethylamino)-3-oxabicyclo[12.4.0]octadeca-1(14),15,17-triene-2,8,9,10-tetrone |
| SMILES | C[C@@H]1CCC(=O)C(=O)C(=O)CCCc2cc(NCC3CCNCC3)cc(O[Si](C)(C)C(C)(C)C)c2C(=O)O[C@H]1C |
| InChI | InChI=1S/C31H48N2O6Si/c1-20-11-12-26(35)29(36)25(34)10-8-9-23-17-24(33-19-22-13-15-32-16-14-22)18-27(28(23)30(37)38-21(20)2)39-40(6,7)31(3,4)5/h17-18,20-22,32-33H,8-16,19H2,1-7H3/t20-,21+/m1/s1 |
| InChIKey | BXYBQQAGLDGRJM-RTWAWAEBSA-N |
| XLogP | 5.49 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.82 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|