About 2-chloro-3-(1-methyl-3,4-dihydro-2H-pyrrol-1-ium-5-yl)pyridine
2-chloro-3-(1-methyl-3,4-dihydro-2H-pyrrol-1-ium-5-yl)pyridine (PubChem CID 123609801) has the molecular formula C10H12ClN2+
and a molecular weight of 195.67 g/mol. Its IUPAC name is 2-chloro-3-(1-methyl-3,4-dihydro-2H-pyrrol-1-ium-5-yl)pyridine.
Molecular Properties
| Compound Name | 2-chloro-3-(1-methyl-3,4-dihydro-2H-pyrrol-1-ium-5-yl)pyridine |
| PubChem CID | 123609801 |
| Molecular Formula | C10H12ClN2+ |
| Molecular Weight | 195.67 g/mol |
| Exact Mass | 195.07 |
| IUPAC Name | 2-chloro-3-(1-methyl-3,4-dihydro-2H-pyrrol-1-ium-5-yl)pyridine |
| SMILES | C[N+]1=C(c2cccnc2Cl)CCC1 |
| InChI | InChI=1S/C10H12ClN2/c1-13-7-3-5-9(13)8-4-2-6-12-10(8)11/h2,4,6H,3,5,7H2,1H3/q+1 |
| InChIKey | UQCLJOGFPVUDNP-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 15.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.67 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-3-(1-methyl-3,4-dihydro-2H-pyrrol-1-ium-5-yl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-3-(1-methyl-3,4-dihydro-2H-pyrrol-1-ium-5-yl)pyridine?
The IUPAC name of 2-chloro-3-(1-methyl-3,4-dihydro-2H-pyrrol-1-ium-5-yl)pyridine (CID 123609801) is 2-chloro-3-(1-methyl-3,4-dihydro-2H-pyrrol-1-ium-5-yl)pyridine.
What is the SMILES notation for 2-chloro-3-(1-methyl-3,4-dihydro-2H-pyrrol-1-ium-5-yl)pyridine?
The canonical SMILES for 2-chloro-3-(1-methyl-3,4-dihydro-2H-pyrrol-1-ium-5-yl)pyridine is C[N+]1=C(c2cccnc2Cl)CCC1.
What is the InChIKey of 2-chloro-3-(1-methyl-3,4-dihydro-2H-pyrrol-1-ium-5-yl)pyridine?
The InChIKey is UQCLJOGFPVUDNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12ClN2/c1-13-7-3-5-9(13)8-4-2-6-12-10(8)11/h2,4,6H,3,5,7H2,1H3/q+1.
What are the key properties of 2-chloro-3-(1-methyl-3,4-dihydro-2H-pyrrol-1-ium-5-yl)pyridine?
2-chloro-3-(1-methyl-3,4-dihydro-2H-pyrrol-1-ium-5-yl)pyridine has a molecular weight of 195.67 g/mol, XLogP of 1.96, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-3-(1-methyl-3,4-dihydro-2H-pyrrol-1-ium-5-yl)pyridine is sourced from PubChem (CID 123609801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).