C25H24Cl2N4O4 — CID 123610363
N-[2-[[6-(2,6-dichloro-3,5-dimethoxyphenyl)-8-methoxyquinazolin-2-yl]amino]cyclopentyl]prop-2-ynamide (PubChem CID 123610363) has the molecular formula C25H24Cl2N4O4 and a molecular weight of 515.40 g/mol. Its IUPAC name is N-[2-[[6-(2,6-dichloro-3,5-dimethoxyphenyl)-8-methoxyquinazolin-2-yl]amino]cyclopentyl]prop-2-ynamide.
| Compound Name | N-[2-[[6-(2,6-dichloro-3,5-dimethoxyphenyl)-8-methoxyquinazolin-2-yl]amino]cyclopentyl]prop-2-ynamide |
|---|---|
| PubChem CID | 123610363 |
| Molecular Formula | C25H24Cl2N4O4 |
| Molecular Weight | 515.40 g/mol |
| Exact Mass | 514.12 |
| IUPAC Name | N-[2-[[6-(2,6-dichloro-3,5-dimethoxyphenyl)-8-methoxyquinazolin-2-yl]amino]cyclopentyl]prop-2-ynamide |
| SMILES | C#CC(=O)NC1CCCC1Nc1ncc2cc(-c3c(Cl)c(OC)cc(OC)c3Cl)cc(OC)c2n1 |
| InChI | InChI=1S/C25H24Cl2N4O4/c1-5-20(32)29-15-7-6-8-16(15)30-25-28-12-14-9-13(10-19(35-4)24(14)31-25)21-22(26)17(33-2)11-18(34-3)23(21)27/h1,9-12,15-16H,6-8H2,2-4H3,(H,29,32)(H,28,30,31) |
| InChIKey | DARRVGCHJJBMCI-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 94.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.40 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|