C35H36Br2N2O2+2 — CID 123610427
7,9-bis(4-bromo-2,6-dimethylphenyl)-8-methyl-8H-acenaphthyleno[1,2-d]imidazole-7,9-diium;methyl 2-methylpropanoate (PubChem CID 123610427) has the molecular formula C35H36Br2N2O2+2 and a molecular weight of 676.49 g/mol. Its IUPAC name is 7,9-bis(4-bromo-2,6-dimethylphenyl)-8-methyl-8H-acenaphthyleno[1,2-d]imidazole-7,9-diium;methyl 2-methylpropanoate.
| Compound Name | 7,9-bis(4-bromo-2,6-dimethylphenyl)-8-methyl-8H-acenaphthyleno[1,2-d]imidazole-7,9-diium;methyl 2-methylpropanoate |
|---|---|
| PubChem CID | 123610427 |
| Molecular Formula | C35H36Br2N2O2+2 |
| Molecular Weight | 676.49 g/mol |
| Exact Mass | 674.11 |
| IUPAC Name | 7,9-bis(4-bromo-2,6-dimethylphenyl)-8-methyl-8H-acenaphthyleno[1,2-d]imidazole-7,9-diium;methyl 2-methylpropanoate |
| SMILES | COC(=O)C(C)C.Cc1cc(Br)cc(C)c1[N+]1=C2C(=[N+](c3c(C)cc(Br)cc3C)C1C)c1cccc3cccc2c13 |
| InChI | InChI=1S/C30H26Br2N2.C5H10O2/c1-16-12-22(31)13-17(2)27(16)33-20(5)34(28-18(3)14-23(32)15-19(28)4)30-25-11-7-9-21-8-6-10-24(26(21)25)29(30)33;1-4(2)5(6)7-3/h6-15,20H,1-5H3;4H,1-3H3/q+2; |
| InChIKey | RATKBZSABLHLPO-UHFFFAOYSA-N |
| XLogP | 9.05 |
| TPSA | 32.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.49 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|