About 5-methylhexyl acetate;trimethyl(2-methylpropyl)silane
5-methylhexyl acetate;trimethyl(2-methylpropyl)silane (PubChem CID 123610490) has the molecular formula C16H36O2Si
and a molecular weight of 288.55 g/mol. Its IUPAC name is 5-methylhexyl acetate;trimethyl(2-methylpropyl)silane.
Molecular Properties
| Compound Name | 5-methylhexyl acetate;trimethyl(2-methylpropyl)silane |
| PubChem CID | 123610490 |
| Molecular Formula | C16H36O2Si |
| Molecular Weight | 288.55 g/mol |
| Exact Mass | 288.25 |
| IUPAC Name | 5-methylhexyl acetate;trimethyl(2-methylpropyl)silane |
| SMILES | CC(=O)OCCCCC(C)C.CC(C)C[Si](C)(C)C |
| InChI | InChI=1S/C9H18O2.C7H18Si/c1-8(2)6-4-5-7-11-9(3)10;1-7(2)6-8(3,4)5/h8H,4-7H2,1-3H3;7H,6H2,1-5H3 |
| InChIKey | HRJWVDWGFZQWQG-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 288.55 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 5-methylhexyl acetate;trimethyl(2-methylpropyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methylhexyl acetate;trimethyl(2-methylpropyl)silane?
The IUPAC name of 5-methylhexyl acetate;trimethyl(2-methylpropyl)silane (CID 123610490) is 5-methylhexyl acetate;trimethyl(2-methylpropyl)silane.
What is the SMILES notation for 5-methylhexyl acetate;trimethyl(2-methylpropyl)silane?
The canonical SMILES for 5-methylhexyl acetate;trimethyl(2-methylpropyl)silane is CC(=O)OCCCCC(C)C.CC(C)C[Si](C)(C)C.
What is the InChIKey of 5-methylhexyl acetate;trimethyl(2-methylpropyl)silane?
The InChIKey is HRJWVDWGFZQWQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18O2.C7H18Si/c1-8(2)6-4-5-7-11-9(3)10;1-7(2)6-8(3,4)5/h8H,4-7H2,1-3H3;7H,6H2,1-5H3.
What are the key properties of 5-methylhexyl acetate;trimethyl(2-methylpropyl)silane?
5-methylhexyl acetate;trimethyl(2-methylpropyl)silane has a molecular weight of 288.55 g/mol, XLogP of 5.36, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methylhexyl acetate;trimethyl(2-methylpropyl)silane is sourced from PubChem (CID 123610490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).