C13H18F2N2O — CID 123610723
2-(2-fluorobutoxy)-N'-[(2-fluorophenyl)methyl]ethanimidamide (PubChem CID 123610723) has the molecular formula C13H18F2N2O and a molecular weight of 256.30 g/mol. Its IUPAC name is 2-(2-fluorobutoxy)-N'-[(2-fluorophenyl)methyl]ethanimidamide.
| Compound Name | 2-(2-fluorobutoxy)-N'-[(2-fluorophenyl)methyl]ethanimidamide |
|---|---|
| PubChem CID | 123610723 |
| Molecular Formula | C13H18F2N2O |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | 2-(2-fluorobutoxy)-N'-[(2-fluorophenyl)methyl]ethanimidamide |
| SMILES | CCC(F)COC/C(N)=N\Cc1ccccc1F |
| InChI | InChI=1S/C13H18F2N2O/c1-2-11(14)8-18-9-13(16)17-7-10-5-3-4-6-12(10)15/h3-6,11H,2,7-9H2,1H3,(H2,16,17) |
| InChIKey | RWQHNUVSTPEMAF-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|