About (2-methyloxan-2-yl)-(3,3,3-trifluoropropyl)silane
(2-methyloxan-2-yl)-(3,3,3-trifluoropropyl)silane (PubChem CID 123611137) has the molecular formula C9H17F3OSi
and a molecular weight of 226.31 g/mol. Its IUPAC name is (2-methyloxan-2-yl)-(3,3,3-trifluoropropyl)silane.
Molecular Properties
| Compound Name | (2-methyloxan-2-yl)-(3,3,3-trifluoropropyl)silane |
| PubChem CID | 123611137 |
| Molecular Formula | C9H17F3OSi |
| Molecular Weight | 226.31 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | (2-methyloxan-2-yl)-(3,3,3-trifluoropropyl)silane |
| SMILES | CC1([SiH2]CCC(F)(F)F)CCCCO1 |
| InChI | InChI=1S/C9H17F3OSi/c1-8(4-2-3-6-13-8)14-7-5-9(10,11)12/h2-7,14H2,1H3 |
| InChIKey | JGCQXNQEHJFNAK-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.31 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (2-methyloxan-2-yl)-(3,3,3-trifluoropropyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methyloxan-2-yl)-(3,3,3-trifluoropropyl)silane?
The IUPAC name of (2-methyloxan-2-yl)-(3,3,3-trifluoropropyl)silane (CID 123611137) is (2-methyloxan-2-yl)-(3,3,3-trifluoropropyl)silane.
What is the SMILES notation for (2-methyloxan-2-yl)-(3,3,3-trifluoropropyl)silane?
The canonical SMILES for (2-methyloxan-2-yl)-(3,3,3-trifluoropropyl)silane is CC1([SiH2]CCC(F)(F)F)CCCCO1.
What is the InChIKey of (2-methyloxan-2-yl)-(3,3,3-trifluoropropyl)silane?
The InChIKey is JGCQXNQEHJFNAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17F3OSi/c1-8(4-2-3-6-13-8)14-7-5-9(10,11)12/h2-7,14H2,1H3.
What are the key properties of (2-methyloxan-2-yl)-(3,3,3-trifluoropropyl)silane?
(2-methyloxan-2-yl)-(3,3,3-trifluoropropyl)silane has a molecular weight of 226.31 g/mol, XLogP of 2.44, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methyloxan-2-yl)-(3,3,3-trifluoropropyl)silane is sourced from PubChem (CID 123611137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).