About N-(1,3-dioxolan-4-ylmethyl)nona-2,4-dienamide
N-(1,3-dioxolan-4-ylmethyl)nona-2,4-dienamide (PubChem CID 123611494) has the molecular formula C13H21NO3
and a molecular weight of 239.31 g/mol. Its IUPAC name is N-(1,3-dioxolan-4-ylmethyl)nona-2,4-dienamide.
Molecular Properties
| Compound Name | N-(1,3-dioxolan-4-ylmethyl)nona-2,4-dienamide |
| PubChem CID | 123611494 |
| Molecular Formula | C13H21NO3 |
| Molecular Weight | 239.31 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | N-(1,3-dioxolan-4-ylmethyl)nona-2,4-dienamide |
| SMILES | CCCCC=CC=CC(=O)NCC1COCO1 |
| InChI | InChI=1S/C13H21NO3/c1-2-3-4-5-6-7-8-13(15)14-9-12-10-16-11-17-12/h5-8,12H,2-4,9-11H2,1H3,(H,14,15) |
| InChIKey | GNHMORVZGGZWRJ-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.31 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-(1,3-dioxolan-4-ylmethyl)nona-2,4-dienamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1,3-dioxolan-4-ylmethyl)nona-2,4-dienamide?
The IUPAC name of N-(1,3-dioxolan-4-ylmethyl)nona-2,4-dienamide (CID 123611494) is N-(1,3-dioxolan-4-ylmethyl)nona-2,4-dienamide.
What is the SMILES notation for N-(1,3-dioxolan-4-ylmethyl)nona-2,4-dienamide?
The canonical SMILES for N-(1,3-dioxolan-4-ylmethyl)nona-2,4-dienamide is CCCCC=CC=CC(=O)NCC1COCO1.
What is the InChIKey of N-(1,3-dioxolan-4-ylmethyl)nona-2,4-dienamide?
The InChIKey is GNHMORVZGGZWRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21NO3/c1-2-3-4-5-6-7-8-13(15)14-9-12-10-16-11-17-12/h5-8,12H,2-4,9-11H2,1H3,(H,14,15).
What are the key properties of N-(1,3-dioxolan-4-ylmethyl)nona-2,4-dienamide?
N-(1,3-dioxolan-4-ylmethyl)nona-2,4-dienamide has a molecular weight of 239.31 g/mol, XLogP of 1.78, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1,3-dioxolan-4-ylmethyl)nona-2,4-dienamide is sourced from PubChem (CID 123611494), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).