C38H27F3N6O4 — CID 123611632
3-(1,1-difluoroethyl)-N-(3-fluoro-5-pyrimidin-5-yloxyphenyl)benzamide;3-ethynyl-N-(3-pyrimidin-5-yloxyphenyl)benzamide (PubChem CID 123611632) has the molecular formula C38H27F3N6O4 and a molecular weight of 688.67 g/mol. Its IUPAC name is 3-(1,1-difluoroethyl)-N-(3-fluoro-5-pyrimidin-5-yloxyphenyl)benzamide;3-ethynyl-N-(3-pyrimidin-5-yloxyphenyl)benzamide.
| Compound Name | 3-(1,1-difluoroethyl)-N-(3-fluoro-5-pyrimidin-5-yloxyphenyl)benzamide;3-ethynyl-N-(3-pyrimidin-5-yloxyphenyl)benzamide |
|---|---|
| PubChem CID | 123611632 |
| Molecular Formula | C38H27F3N6O4 |
| Molecular Weight | 688.67 g/mol |
| Exact Mass | 688.20 |
| IUPAC Name | 3-(1,1-difluoroethyl)-N-(3-fluoro-5-pyrimidin-5-yloxyphenyl)benzamide;3-ethynyl-N-(3-pyrimidin-5-yloxyphenyl)benzamide |
| SMILES | C#Cc1cccc(C(=O)Nc2cccc(Oc3cncnc3)c2)c1.CC(F)(F)c1cccc(C(=O)Nc2cc(F)cc(Oc3cncnc3)c2)c1 |
| InChI | InChI=1S/C19H14F3N3O2.C19H13N3O2/c1-19(21,22)13-4-2-3-12(5-13)18(26)25-15-6-14(20)7-16(8-15)27-17-9-23-11-24-10-17;1-2-14-5-3-6-15(9-14)19(23)22-16-7-4-8-17(10-16)24-18-11-20-13-21-12-18/h2-11H,1H3,(H,25,26);1,3-13H,(H,22,23) |
| InChIKey | UCJBQQLPTQLTDZ-UHFFFAOYSA-N |
| XLogP | 8.27 |
| TPSA | 128.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.67 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|